C12H8BrCl2N3O — CID 103715596
N-(5-bromo-6-methyl-2-pyridinyl)-2,6-dichloropyridine-3-carboxamide (PubChem CID 103715596) has the molecular formula C12H8BrCl2N3O and a molecular weight of 361.03 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-2,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-2,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 103715596 |
| Molecular Formula | C12H8BrCl2N3O |
| Molecular Weight | 361.03 g/mol |
| Exact Mass | 358.92 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-2,6-dichloropyridine-3-carboxamide |
| SMILES | Cc1nc(NC(=O)c2ccc(Cl)nc2Cl)ccc1Br |
| InChI | InChI=1S/C12H8BrCl2N3O/c1-6-8(13)3-5-10(16-6)18-12(19)7-2-4-9(14)17-11(7)15/h2-5H,1H3,(H,16,18,19) |
| InChIKey | SHQLMJJJGFVLHZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|