C23H15Cl2N3O4S — CID 1395615
5-(2,3-dichlorophenyl)-N-[[3-(furan-2-carbonylamino)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 1395615) has the molecular formula C23H15Cl2N3O4S and a molecular weight of 500.36 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[[3-(furan-2-carbonylamino)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[[3-(furan-2-carbonylamino)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1395615 |
| Molecular Formula | C23H15Cl2N3O4S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[[3-(furan-2-carbonylamino)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=S)NC(=O)c2ccc(-c3cccc(Cl)c3Cl)o2)c1)c1ccco1 |
| InChI | InChI=1S/C23H15Cl2N3O4S/c24-16-7-2-6-15(20(16)25)17-9-10-19(32-17)22(30)28-23(33)27-14-5-1-4-13(12-14)26-21(29)18-8-3-11-31-18/h1-12H,(H,26,29)(H2,27,28,30,33) |
| InChIKey | NKINGGZWWVYYDU-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|