C20H20ClFN4O2S — CID 22780176
N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-fluorobenzamide (PubChem CID 22780176) has the molecular formula C20H20ClFN4O2S and a molecular weight of 434.92 g/mol. Its IUPAC name is N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 22780176 |
| Molecular Formula | C20H20ClFN4O2S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2-fluorobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccccc3F)cc2Cl)CC1 |
| InChI | InChI=1S/C20H20ClFN4O2S/c1-13(27)25-8-10-26(11-9-25)18-7-6-14(12-16(18)21)23-20(29)24-19(28)15-4-2-3-5-17(15)22/h2-7,12H,8-11H2,1H3,(H2,23,24,28,29) |
| InChIKey | VZWMLMQLLRDQLA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|