C16H17NO3 — CID 95624806
N-[(1R,2S)-2-phenoxycyclopentyl]furan-2-carboxamide (PubChem CID 95624806) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[(1R,2S)-2-phenoxycyclopentyl]furan-2-carboxamide.
| Compound Name | N-[(1R,2S)-2-phenoxycyclopentyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95624806 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[(1R,2S)-2-phenoxycyclopentyl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1Oc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C16H17NO3/c18-16(15-10-5-11-19-15)17-13-8-4-9-14(13)20-12-6-2-1-3-7-12/h1-3,5-7,10-11,13-14H,4,8-9H2,(H,17,18)/t13-,14+/m1/s1 |
| InChIKey | HKVZIHRPQAYZSB-KGLIPLIRSA-N |
| XLogP | 3.01 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |