C24H24N2O5 — CID 86974264
N-[4-[[4-(2-hydroxycyclohexyl)oxyphenyl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 86974264) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[4-[[4-(2-hydroxycyclohexyl)oxyphenyl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[4-(2-hydroxycyclohexyl)oxyphenyl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86974264 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[4-[[4-(2-hydroxycyclohexyl)oxyphenyl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCCCC2O)cc1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C24H24N2O5/c27-20-4-1-2-5-21(20)31-19-13-11-18(12-14-19)25-23(28)16-7-9-17(10-8-16)26-24(29)22-6-3-15-30-22/h3,6-15,20-21,27H,1-2,4-5H2,(H,25,28)(H,26,29) |
| InChIKey | LCOKRPHYHHBLHP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |