C22H19N3O4 — CID 9371428
N-[4-[[4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 9371428) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[4-[[4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9371428 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[4-[[4-(2-oxopyrrolidin-1-yl)phenyl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2=O)cc1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H19N3O4/c26-20-4-1-13-25(20)18-11-9-17(10-12-18)23-21(27)15-5-7-16(8-6-15)24-22(28)19-3-2-14-29-19/h2-3,5-12,14H,1,4,13H2,(H,23,27)(H,24,28) |
| InChIKey | ALJYQPHUSHSMEY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |