C16H17N3O3 — CID 110666832
N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carboxamide (PubChem CID 110666832) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110666832 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]furan-2-carboxamide |
| SMILES | CN1CCCN(c2ccc(NC(=O)c3ccco3)cc2)C1=O |
| InChI | InChI=1S/C16H17N3O3/c1-18-9-3-10-19(16(18)21)13-7-5-12(6-8-13)17-15(20)14-4-2-11-22-14/h2,4-8,11H,3,9-10H2,1H3,(H,17,20) |
| InChIKey | ITIYMIGVBPEVAJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |