C14H13N3O3 — CID 51299859
N-[4-(2-oxoimidazolidin-1-yl)phenyl]furan-2-carboxamide (PubChem CID 51299859) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-[4-(2-oxoimidazolidin-1-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(2-oxoimidazolidin-1-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51299859 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[4-(2-oxoimidazolidin-1-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCNC2=O)cc1)c1ccco1 |
| InChI | InChI=1S/C14H13N3O3/c18-13(12-2-1-9-20-12)16-10-3-5-11(6-4-10)17-8-7-15-14(17)19/h1-6,9H,7-8H2,(H,15,19)(H,16,18) |
| InChIKey | MIFSGWLWNDNMSZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |