C17H24N4O2 — CID 110666930
1-cyclopentyl-3-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]urea (PubChem CID 110666930) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]urea.
| Compound Name | 1-cyclopentyl-3-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 110666930 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-cyclopentyl-3-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]urea |
| SMILES | CN1CCCN(c2ccc(NC(=O)NC3CCCC3)cc2)C1=O |
| InChI | InChI=1S/C17H24N4O2/c1-20-11-4-12-21(17(20)23)15-9-7-14(8-10-15)19-16(22)18-13-5-2-3-6-13/h7-10,13H,2-6,11-12H2,1H3,(H2,18,19,22) |
| InChIKey | KUDRDPZXLOCCRO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |