C22H29N3O2 — CID 110666871
N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]adamantane-1-carboxamide (PubChem CID 110666871) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110666871 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-[4-(3-methyl-2-oxo-1,3-diazinan-1-yl)phenyl]adamantane-1-carboxamide |
| SMILES | CN1CCCN(c2ccc(NC(=O)C34CC5CC(CC(C5)C3)C4)cc2)C1=O |
| InChI | InChI=1S/C22H29N3O2/c1-24-7-2-8-25(21(24)27)19-5-3-18(4-6-19)23-20(26)22-12-15-9-16(13-22)11-17(10-15)14-22/h3-6,15-17H,2,7-14H2,1H3,(H,23,26) |
| InChIKey | PMYVPQLOJOQXCE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |