C19H25NO — CID 762997
(3S,6R)-N-(4-methylphenyl)tricyclo[4.3.1.13,8]undecane-1-carboxamide (PubChem CID 762997) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (3S,6R)-N-(4-methylphenyl)tricyclo[4.3.1.13,8]undecane-1-carboxamide.
| Compound Name | (3S,6R)-N-(4-methylphenyl)tricyclo[4.3.1.13,8]undecane-1-carboxamide |
|---|---|
| PubChem CID | 762997 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (3S,6R)-N-(4-methylphenyl)tricyclo[4.3.1.13,8]undecane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C23CC4C[C@@H](CC[C@@H](C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H25NO/c1-13-2-6-17(7-3-13)20-18(21)19-10-14-4-5-15(11-19)9-16(8-14)12-19/h2-3,6-7,14-16H,4-5,8-12H2,1H3,(H,20,21)/t14-,15+,16?,19? |
| InChIKey | HBZDBGIXANRMFE-JOUKPKRSSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |