C19H25NO2 — CID 935322
(1S,8R)-N-(4-methoxyphenyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide (PubChem CID 935322) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (1S,8R)-N-(4-methoxyphenyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide.
| Compound Name | (1S,8R)-N-(4-methoxyphenyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide |
|---|---|
| PubChem CID | 935322 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1S,8R)-N-(4-methoxyphenyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C23CCC4C[C@H](C[C@H](C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-22-17-4-2-16(3-5-17)20-18(21)19-7-6-13-8-14(11-19)10-15(9-13)12-19/h2-5,13-15H,6-12H2,1H3,(H,20,21)/t13?,14-,15+,19? |
| InChIKey | LNICCFUSYNLUIT-LVFIWVQCSA-N |
| XLogP | 4.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |