C19H23NO3 — CID 6990096
4-[[(3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carbonyl]amino]benzoic acid (PubChem CID 6990096) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[[(3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6990096 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-[[(3S,6R)-tricyclo[4.3.1.13,8]undecane-1-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C23CC4C[C@@H](CC[C@@H](C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H23NO3/c21-17(22)15-3-5-16(6-4-15)20-18(23)19-9-12-1-2-13(10-19)8-14(7-12)11-19/h3-6,12-14H,1-2,7-11H2,(H,20,23)(H,21,22)/t12-,13+,14?,19? |
| InChIKey | DXQOHYKEQVEAER-QCDJMGEHSA-N |
| XLogP | 3.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |