C18H20ClNO3 — CID 23888644
3-(adamantane-1-carbonylamino)-4-chlorobenzoic acid (PubChem CID 23888644) has the molecular formula C18H20ClNO3 and a molecular weight of 333.81 g/mol. Its IUPAC name is 3-(adamantane-1-carbonylamino)-4-chlorobenzoic acid.
| Compound Name | 3-(adamantane-1-carbonylamino)-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 23888644 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-(adamantane-1-carbonylamino)-4-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(NC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C18H20ClNO3/c19-14-2-1-13(16(21)22)6-15(14)20-17(23)18-7-10-3-11(8-18)5-12(4-10)9-18/h1-2,6,10-12H,3-5,7-9H2,(H,20,23)(H,21,22) |
| InChIKey | AQGZQQBQPIBBCY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |