C17H21ClN2O — CID 16772902
N-(3-amino-4-chlorophenyl)adamantane-1-carboxamide (PubChem CID 16772902) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)adamantane-1-carboxamide.
| Compound Name | N-(3-amino-4-chlorophenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 16772902 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)adamantane-1-carboxamide |
| SMILES | Nc1cc(NC(=O)C23CC4CC(CC(C4)C2)C3)ccc1Cl |
| InChI | InChI=1S/C17H21ClN2O/c18-14-2-1-13(6-15(14)19)20-16(21)17-7-10-3-11(8-17)5-12(4-10)9-17/h1-2,6,10-12H,3-5,7-9,19H2,(H,20,21) |
| InChIKey | GJJDMBHOCIJURT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|