C21H26N2O4 — CID 74014503
4-[4-(adamantane-1-carbonylamino)phenyl]-4-hydroxyiminobutanoic acid (PubChem CID 74014503) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[4-(adamantane-1-carbonylamino)phenyl]-4-hydroxyiminobutanoic acid.
| Compound Name | 4-[4-(adamantane-1-carbonylamino)phenyl]-4-hydroxyiminobutanoic acid |
|---|---|
| PubChem CID | 74014503 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-[4-(adamantane-1-carbonylamino)phenyl]-4-hydroxyiminobutanoic acid |
| SMILES | O=C(O)CCC(=NO)c1ccc(NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H26N2O4/c24-19(25)6-5-18(23-27)16-1-3-17(4-2-16)22-20(26)21-10-13-7-14(11-21)9-15(8-13)12-21/h1-4,13-15,27H,5-12H2,(H,22,26)(H,24,25) |
| InChIKey | YSIQQGQTHZRPHL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|