C19H20N2O6 — CID 74014498
4-[4-[(3,5-dimethoxybenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid (PubChem CID 74014498) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-[4-[(3,5-dimethoxybenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid.
| Compound Name | 4-[4-[(3,5-dimethoxybenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid |
|---|---|
| PubChem CID | 74014498 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-[4-[(3,5-dimethoxybenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(C(CCC(=O)O)=NO)cc2)c1 |
| InChI | InChI=1S/C19H20N2O6/c1-26-15-9-13(10-16(11-15)27-2)19(24)20-14-5-3-12(4-6-14)17(21-25)7-8-18(22)23/h3-6,9-11,25H,7-8H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | HPZYFIMVTVWSPY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|