C17H14F2N2O4 — CID 74014492
4-[4-[(2,4-difluorobenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid (PubChem CID 74014492) has the molecular formula C17H14F2N2O4 and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-[4-[(2,4-difluorobenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid.
| Compound Name | 4-[4-[(2,4-difluorobenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid |
|---|---|
| PubChem CID | 74014492 |
| Molecular Formula | C17H14F2N2O4 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-[4-[(2,4-difluorobenzoyl)amino]phenyl]-4-hydroxyiminobutanoic acid |
| SMILES | O=C(O)CCC(=NO)c1ccc(NC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H14F2N2O4/c18-11-3-6-13(14(19)9-11)17(24)20-12-4-1-10(2-5-12)15(21-25)7-8-16(22)23/h1-6,9,25H,7-8H2,(H,20,24)(H,22,23) |
| InChIKey | UUTKMFOCJHPUQE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|