C25H19N3O5 — CID 56545953
N-[4-[[4-(4-carbamoylphenoxy)benzoyl]amino]phenyl]furan-2-carboxamide (PubChem CID 56545953) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is N-[4-[[4-(4-carbamoylphenoxy)benzoyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[4-(4-carbamoylphenoxy)benzoyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56545953 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[4-[[4-(4-carbamoylphenoxy)benzoyl]amino]phenyl]furan-2-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)Nc3ccc(NC(=O)c4ccco4)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H19N3O5/c26-23(29)16-3-11-20(12-4-16)33-21-13-5-17(6-14-21)24(30)27-18-7-9-19(10-8-18)28-25(31)22-2-1-15-32-22/h1-15H,(H2,26,29)(H,27,30)(H,28,31) |
| InChIKey | IYUPVSXVQNAHQH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |