C24H18N4O4 — CID 56548979
4-[4-[(4-pyrimidin-2-yloxyphenyl)carbamoyl]phenoxy]benzamide (PubChem CID 56548979) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 4-[4-[(4-pyrimidin-2-yloxyphenyl)carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(4-pyrimidin-2-yloxyphenyl)carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548979 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 4-[4-[(4-pyrimidin-2-yloxyphenyl)carbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)Nc3ccc(Oc4ncccn4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H18N4O4/c25-22(29)16-2-8-19(9-3-16)31-20-10-4-17(5-11-20)23(30)28-18-6-12-21(13-7-18)32-24-26-14-1-15-27-24/h1-15H,(H2,25,29)(H,28,30) |
| InChIKey | LIVVCJHRHVAUPY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |