C18H23N3O2 — CID 96531761
3-(1-methylpyrazol-4-yl)-N-[(1S,2R)-2-phenoxycyclopentyl]propanamide (PubChem CID 96531761) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-N-[(1S,2R)-2-phenoxycyclopentyl]propanamide.
| Compound Name | 3-(1-methylpyrazol-4-yl)-N-[(1S,2R)-2-phenoxycyclopentyl]propanamide |
|---|---|
| PubChem CID | 96531761 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-N-[(1S,2R)-2-phenoxycyclopentyl]propanamide |
| SMILES | Cn1cc(CCC(=O)N[C@H]2CCC[C@H]2Oc2ccccc2)cn1 |
| InChI | InChI=1S/C18H23N3O2/c1-21-13-14(12-19-21)10-11-18(22)20-16-8-5-9-17(16)23-15-6-3-2-4-7-15/h2-4,6-7,12-13,16-17H,5,8-11H2,1H3,(H,20,22)/t16-,17+/m0/s1 |
| InChIKey | DOTQLHTVWKZESX-DLBZAZTESA-N |
| XLogP | 2.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |