C20H28N2O3 — CID 95625915
N-[4-oxo-4-[[(1S,2S)-2-phenoxycyclohexyl]amino]butyl]cyclopropanecarboxamide (PubChem CID 95625915) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is N-[4-oxo-4-[[(1S,2S)-2-phenoxycyclohexyl]amino]butyl]cyclopropanecarboxamide.
| Compound Name | N-[4-oxo-4-[[(1S,2S)-2-phenoxycyclohexyl]amino]butyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 95625915 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[4-oxo-4-[[(1S,2S)-2-phenoxycyclohexyl]amino]butyl]cyclopropanecarboxamide |
| SMILES | O=C(CCCNC(=O)C1CC1)N[C@H]1CCCC[C@@H]1Oc1ccccc1 |
| InChI | InChI=1S/C20H28N2O3/c23-19(11-6-14-21-20(24)15-12-13-15)22-17-9-4-5-10-18(17)25-16-7-2-1-3-8-16/h1-3,7-8,15,17-18H,4-6,9-14H2,(H,21,24)(H,22,23)/t17-,18-/m0/s1 |
| InChIKey | XTSPPYLWDXKUBG-ROUUACIJSA-N |
| XLogP | 2.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|