C18H22N2O4 — CID 75374447
5-(methoxymethyl)-N-(2-phenoxycyclohexyl)-1,2-oxazole-3-carboxamide (PubChem CID 75374447) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-(2-phenoxycyclohexyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-(2-phenoxycyclohexyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 75374447 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-(methoxymethyl)-N-(2-phenoxycyclohexyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)NC2CCCCC2Oc2ccccc2)no1 |
| InChI | InChI=1S/C18H22N2O4/c1-22-12-14-11-16(20-24-14)18(21)19-15-9-5-6-10-17(15)23-13-7-3-2-4-8-13/h2-4,7-8,11,15,17H,5-6,9-10,12H2,1H3,(H,19,21) |
| InChIKey | HMGMDUYAXNSPHZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |