C11H16N2O4 — CID 83202345
N-cyclopentyloxy-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 83202345) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-cyclopentyloxy-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-cyclopentyloxy-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 83202345 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-cyclopentyloxy-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)NOC2CCCC2)no1 |
| InChI | InChI=1S/C11H16N2O4/c1-15-7-9-6-10(12-17-9)11(14)13-16-8-4-2-3-5-8/h6,8H,2-5,7H2,1H3,(H,13,14) |
| InChIKey | BEMFFKSKQVFGMT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|