C15H15ClN2O3 — CID 114302101
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 114302101) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 114302101 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)NC2c3ccccc3CC2Cl)no1 |
| InChI | InChI=1S/C15H15ClN2O3/c1-20-8-10-7-13(18-21-10)15(19)17-14-11-5-3-2-4-9(11)6-12(14)16/h2-5,7,12,14H,6,8H2,1H3,(H,17,19) |
| InChIKey | HMSGAMDKXFSKRD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|