C16H13ClFNO — CID 114302198
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-fluorobenzamide (PubChem CID 114302198) has the molecular formula C16H13ClFNO and a molecular weight of 289.74 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-fluorobenzamide.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 114302198 |
| Molecular Formula | C16H13ClFNO |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-4-fluorobenzamide |
| SMILES | O=C(NC1c2ccccc2CC1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13ClFNO/c17-14-9-11-3-1-2-4-13(11)15(14)19-16(20)10-5-7-12(18)8-6-10/h1-8,14-15H,9H2,(H,19,20) |
| InChIKey | KIFAHRYOTGZATB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|