C14H10Br2ClNOS — CID 114302056
4,5-dibromo-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)thiophene-2-carboxamide (PubChem CID 114302056) has the molecular formula C14H10Br2ClNOS and a molecular weight of 435.57 g/mol. Its IUPAC name is 4,5-dibromo-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114302056 |
| Molecular Formula | C14H10Br2ClNOS |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 432.85 |
| IUPAC Name | 4,5-dibromo-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC1c2ccccc2CC1Cl)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H10Br2ClNOS/c15-9-6-11(20-13(9)16)14(19)18-12-8-4-2-1-3-7(8)5-10(12)17/h1-4,6,10,12H,5H2,(H,18,19) |
| InChIKey | UGTRSIJUGNRNAL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|