C16H13Br2NO2 — CID 103883197
2,4-dibromo-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 103883197) has the molecular formula C16H13Br2NO2 and a molecular weight of 411.09 g/mol. Its IUPAC name is 2,4-dibromo-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 2,4-dibromo-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 103883197 |
| Molecular Formula | C16H13Br2NO2 |
| Molecular Weight | 411.09 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | 2,4-dibromo-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | O=C(N[C@H]1c2ccccc2C[C@H]1O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H13Br2NO2/c17-10-5-6-12(13(18)8-10)16(21)19-15-11-4-2-1-3-9(11)7-14(15)20/h1-6,8,14-15,20H,7H2,(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | XUIIZKPCLJVTFN-CABCVRRESA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.09 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |