C16H15FN2O2 — CID 107211343
4-amino-2-fluoro-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 107211343) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-amino-2-fluoro-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 4-amino-2-fluoro-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 107211343 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-amino-2-fluoro-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | Nc1ccc(C(=O)N[C@H]2c3ccccc3C[C@H]2O)c(F)c1 |
| InChI | InChI=1S/C16H15FN2O2/c17-13-8-10(18)5-6-12(13)16(21)19-15-11-4-2-1-3-9(11)7-14(15)20/h1-6,8,14-15,20H,7,18H2,(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | VFOJPLBGVVKQDE-CABCVRRESA-N |
| XLogP | 1.80 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|