C18H21FN2O2 — CID 144548156
3-amino-4-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)benzamide;ethane (PubChem CID 144548156) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)benzamide;ethane.
| Compound Name | 3-amino-4-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)benzamide;ethane |
|---|---|
| PubChem CID | 144548156 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-amino-4-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)benzamide;ethane |
| SMILES | CC.Nc1cc(C(=O)NC2c3ccccc3CC2O)ccc1F |
| InChI | InChI=1S/C16H15FN2O2.C2H6/c17-12-6-5-10(7-13(12)18)16(21)19-15-11-4-2-1-3-9(11)8-14(15)20;1-2/h1-7,14-15,20H,8,18H2,(H,19,21);1-2H3 |
| InChIKey | FTQIEZKLDZIDEY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|