C17H15Cl2NO — CID 114302102
3-chloro-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylbenzamide (PubChem CID 114302102) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylbenzamide.
| Compound Name | 3-chloro-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylbenzamide |
|---|---|
| PubChem CID | 114302102 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-chloro-N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylbenzamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NC2c3ccccc3CC2Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO/c1-10-6-12(8-13(18)7-10)17(21)20-16-14-5-3-2-4-11(14)9-15(16)19/h2-8,15-16H,9H2,1H3,(H,20,21) |
| InChIKey | OTPCNXBNOLEHII-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|