C16H15ClN2O — CID 114302241
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylpyridine-3-carboxamide (PubChem CID 114302241) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylpyridine-3-carboxamide.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 114302241 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-methylpyridine-3-carboxamide |
| SMILES | Cc1cncc(C(=O)NC2c3ccccc3CC2Cl)c1 |
| InChI | InChI=1S/C16H15ClN2O/c1-10-6-12(9-18-8-10)16(20)19-15-13-5-3-2-4-11(13)7-14(15)17/h2-6,8-9,14-15H,7H2,1H3,(H,19,20) |
| InChIKey | FNDPQPORABYSEU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|