C17H25NO3 — CID 97006278
N-[(1S,2R)-2-methoxycycloheptyl]-2-(methoxymethyl)benzamide (PubChem CID 97006278) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[(1S,2R)-2-methoxycycloheptyl]-2-(methoxymethyl)benzamide.
| Compound Name | N-[(1S,2R)-2-methoxycycloheptyl]-2-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 97006278 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-[(1S,2R)-2-methoxycycloheptyl]-2-(methoxymethyl)benzamide |
| SMILES | COCc1ccccc1C(=O)N[C@H]1CCCCC[C@H]1OC |
| InChI | InChI=1S/C17H25NO3/c1-20-12-13-8-6-7-9-14(13)17(19)18-15-10-4-3-5-11-16(15)21-2/h6-9,15-16H,3-5,10-12H2,1-2H3,(H,18,19)/t15-,16+/m0/s1 |
| InChIKey | JSHLJBLSFICWOV-JKSUJKDBSA-N |
| XLogP | 2.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |