C13H17NO4 — CID 114344265
2,3-dihydroxy-N-(2-methoxycyclopentyl)benzamide (PubChem CID 114344265) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(2-methoxycyclopentyl)benzamide.
| Compound Name | 2,3-dihydroxy-N-(2-methoxycyclopentyl)benzamide |
|---|---|
| PubChem CID | 114344265 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2,3-dihydroxy-N-(2-methoxycyclopentyl)benzamide |
| SMILES | COC1CCCC1NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C13H17NO4/c1-18-11-7-3-5-9(11)14-13(17)8-4-2-6-10(15)12(8)16/h2,4,6,9,11,15-16H,3,5,7H2,1H3,(H,14,17) |
| InChIKey | IKNLEMJCEXENIP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|