C13H16ClNO3 — CID 114345275
N-(2-chlorocyclohexyl)-2,3-dihydroxybenzamide (PubChem CID 114345275) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(2-chlorocyclohexyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114345275 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-(2-chlorocyclohexyl)-2,3-dihydroxybenzamide |
| SMILES | O=C(NC1CCCCC1Cl)c1cccc(O)c1O |
| InChI | InChI=1S/C13H16ClNO3/c14-9-5-1-2-6-10(9)15-13(18)8-4-3-7-11(16)12(8)17/h3-4,7,9-10,16-17H,1-2,5-6H2,(H,15,18) |
| InChIKey | NKFVMSBRTYNUJQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|