C12H12Cl3NO — CID 106443948
2,3-dichloro-N-(2-chlorocyclopentyl)benzamide (PubChem CID 106443948) has the molecular formula C12H12Cl3NO and a molecular weight of 292.59 g/mol. Its IUPAC name is 2,3-dichloro-N-(2-chlorocyclopentyl)benzamide.
| Compound Name | 2,3-dichloro-N-(2-chlorocyclopentyl)benzamide |
|---|---|
| PubChem CID | 106443948 |
| Molecular Formula | C12H12Cl3NO |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2,3-dichloro-N-(2-chlorocyclopentyl)benzamide |
| SMILES | O=C(NC1CCCC1Cl)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl3NO/c13-8-4-2-6-10(8)16-12(17)7-3-1-5-9(14)11(7)15/h1,3,5,8,10H,2,4,6H2,(H,16,17) |
| InChIKey | KDTPJAZXGMDUPL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|