C19H16Cl2F2N2O2 — CID 154754631
3-chloro-N-[2-[(3-chloro-2-fluorobenzoyl)amino]cyclopentyl]-2-fluorobenzamide (PubChem CID 154754631) has the molecular formula C19H16Cl2F2N2O2 and a molecular weight of 413.25 g/mol. Its IUPAC name is 3-chloro-N-[2-[(3-chloro-2-fluorobenzoyl)amino]cyclopentyl]-2-fluorobenzamide.
| Compound Name | 3-chloro-N-[2-[(3-chloro-2-fluorobenzoyl)amino]cyclopentyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 154754631 |
| Molecular Formula | C19H16Cl2F2N2O2 |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-chloro-N-[2-[(3-chloro-2-fluorobenzoyl)amino]cyclopentyl]-2-fluorobenzamide |
| SMILES | O=C(NC1CCCC1NC(=O)c1cccc(Cl)c1F)c1cccc(Cl)c1F |
| InChI | InChI=1S/C19H16Cl2F2N2O2/c20-12-6-1-4-10(16(12)22)18(26)24-14-8-3-9-15(14)25-19(27)11-5-2-7-13(21)17(11)23/h1-2,4-7,14-15H,3,8-9H2,(H,24,26)(H,25,27) |
| InChIKey | NHXNVDDBQIPRLQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |