C14H18FNO3 — CID 110125479
2-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]benzamide (PubChem CID 110125479) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]benzamide.
| Compound Name | 2-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 110125479 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-fluoro-N-[(1R,2R,3R)-2-hydroxy-3-methoxycyclohexyl]benzamide |
| SMILES | CO[C@@H]1CCC[C@@H](NC(=O)c2ccccc2F)[C@H]1O |
| InChI | InChI=1S/C14H18FNO3/c1-19-12-8-4-7-11(13(12)17)16-14(18)9-5-2-3-6-10(9)15/h2-3,5-6,11-13,17H,4,7-8H2,1H3,(H,16,18)/t11-,12-,13-/m1/s1 |
| InChIKey | SWDHEIHPYANIMC-JHJVBQTASA-N |
| XLogP | 1.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |