C16H20F3NO3 — CID 110125899
N-[(1R,2R,3R)-2-hydroxy-3-methoxycycloheptyl]-2-(trifluoromethyl)benzamide (PubChem CID 110125899) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-methoxycycloheptyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-methoxycycloheptyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 110125899 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-methoxycycloheptyl]-2-(trifluoromethyl)benzamide |
| SMILES | CO[C@@H]1CCCC[C@@H](NC(=O)c2ccccc2C(F)(F)F)[C@H]1O |
| InChI | InChI=1S/C16H20F3NO3/c1-23-13-9-5-4-8-12(14(13)21)20-15(22)10-6-2-3-7-11(10)16(17,18)19/h2-3,6-7,12-14,21H,4-5,8-9H2,1H3,(H,20,22)/t12-,13-,14-/m1/s1 |
| InChIKey | ZYEKSQGYZXBTBA-MGPQQGTHSA-N |
| XLogP | 2.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |