C20H19ClF3NO — CID 125465080
N-[(1R,2R)-2-(4-chlorophenyl)cyclohexyl]-2-(trifluoromethyl)benzamide (PubChem CID 125465080) has the molecular formula C20H19ClF3NO and a molecular weight of 381.83 g/mol. Its IUPAC name is N-[(1R,2R)-2-(4-chlorophenyl)cyclohexyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R,2R)-2-(4-chlorophenyl)cyclohexyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 125465080 |
| Molecular Formula | C20H19ClF3NO |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[(1R,2R)-2-(4-chlorophenyl)cyclohexyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1c1ccc(Cl)cc1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H19ClF3NO/c21-14-11-9-13(10-12-14)15-5-2-4-8-18(15)25-19(26)16-6-1-3-7-17(16)20(22,23)24/h1,3,6-7,9-12,15,18H,2,4-5,8H2,(H,25,26)/t15-,18-/m1/s1 |
| InChIKey | PJNYMGCIDQWDQN-CRAIPNDOSA-N |
| XLogP | 5.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |