C17H15ClF3N3O — CID 123946452
3-chloro-N-[2-[4-(trifluoromethyl)phenyl]cyclopentyl]pyrazine-2-carboxamide (PubChem CID 123946452) has the molecular formula C17H15ClF3N3O and a molecular weight of 369.77 g/mol. Its IUPAC name is 3-chloro-N-[2-[4-(trifluoromethyl)phenyl]cyclopentyl]pyrazine-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[4-(trifluoromethyl)phenyl]cyclopentyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123946452 |
| Molecular Formula | C17H15ClF3N3O |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-chloro-N-[2-[4-(trifluoromethyl)phenyl]cyclopentyl]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCC1c1ccc(C(F)(F)F)cc1)c1nccnc1Cl |
| InChI | InChI=1S/C17H15ClF3N3O/c18-15-14(22-8-9-23-15)16(25)24-13-3-1-2-12(13)10-4-6-11(7-5-10)17(19,20)21/h4-9,12-13H,1-3H2,(H,24,25) |
| InChIKey | GMHJQVGOCLJPMM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |