C17H16Cl2N2O — CID 125491090
2-chloro-N-[(1S,2R)-2-(2-chlorophenyl)cyclopentyl]pyridine-3-carboxamide (PubChem CID 125491090) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-chloro-N-[(1S,2R)-2-(2-chlorophenyl)cyclopentyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(1S,2R)-2-(2-chlorophenyl)cyclopentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125491090 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-chloro-N-[(1S,2R)-2-(2-chlorophenyl)cyclopentyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCC[C@@H]1c1ccccc1Cl)c1cccnc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O/c18-14-8-2-1-5-11(14)12-6-3-9-15(12)21-17(22)13-7-4-10-20-16(13)19/h1-2,4-5,7-8,10,12,15H,3,6,9H2,(H,21,22)/t12-,15+/m1/s1 |
| InChIKey | NYHSFOWNUVEYDC-DOMZBBRYSA-N |
| XLogP | 4.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|