C18H18Cl2N2O — CID 125490711
2-chloro-N-[(1R,2R)-2-(2-chlorophenyl)cyclohexyl]pyridine-3-carboxamide (PubChem CID 125490711) has the molecular formula C18H18Cl2N2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2R)-2-(2-chlorophenyl)cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(1R,2R)-2-(2-chlorophenyl)cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125490711 |
| Molecular Formula | C18H18Cl2N2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-chloro-N-[(1R,2R)-2-(2-chlorophenyl)cyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@@H]1c1ccccc1Cl)c1cccnc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O/c19-15-9-3-1-6-12(15)13-7-2-4-10-16(13)22-18(23)14-8-5-11-21-17(14)20/h1,3,5-6,8-9,11,13,16H,2,4,7,10H2,(H,22,23)/t13-,16-/m1/s1 |
| InChIKey | HARJZEYLZJRJLX-CZUORRHYSA-N |
| XLogP | 4.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|