C18H20ClN3O — CID 118317099
2-chloro-N-[(1S,2S)-2-[(5-methyl-2-pyridinyl)amino]cyclopentyl]benzamide (PubChem CID 118317099) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-chloro-N-[(1S,2S)-2-[(5-methyl-2-pyridinyl)amino]cyclopentyl]benzamide.
| Compound Name | 2-chloro-N-[(1S,2S)-2-[(5-methyl-2-pyridinyl)amino]cyclopentyl]benzamide |
|---|---|
| PubChem CID | 118317099 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-chloro-N-[(1S,2S)-2-[(5-methyl-2-pyridinyl)amino]cyclopentyl]benzamide |
| SMILES | Cc1ccc(N[C@H]2CCC[C@@H]2NC(=O)c2ccccc2Cl)nc1 |
| InChI | InChI=1S/C18H20ClN3O/c1-12-9-10-17(20-11-12)21-15-7-4-8-16(15)22-18(23)13-5-2-3-6-14(13)19/h2-3,5-6,9-11,15-16H,4,7-8H2,1H3,(H,20,21)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | WNLJKMLBTDYOSG-HOTGVXAUSA-N |
| XLogP | 3.81 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |