About cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine
cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine (PubChem CID 159909589) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine.
Molecular Properties
| Compound Name | cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine |
| PubChem CID | 159909589 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine |
| SMILES | Cc1ccc(N[C@H]2CCC[C@H]2N)nc1 |
| InChI | InChI=1S/C11H17N3/c1-8-5-6-11(13-7-8)14-10-4-2-3-9(10)12/h5-7,9-10H,2-4,12H2,1H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | NWZYMCMCFSTXLP-ZJUUUORDSA-N |
| XLogP | 1.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine?
The IUPAC name of cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine (CID 159909589) is cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine.
What is the SMILES notation for cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine?
The canonical SMILES for cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine is Cc1ccc(N[C@H]2CCC[C@H]2N)nc1.
What is the InChIKey of cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine?
The InChIKey is NWZYMCMCFSTXLP-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H17N3/c1-8-5-6-11(13-7-8)14-10-4-2-3-9(10)12/h5-7,9-10H,2-4,12H2,1H3,(H,13,14)/t9-,10+/m1/s1.
What are the key properties of cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine?
cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine has a molecular weight of 191.28 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-1-N-(5-methyl-2-pyridinyl)cyclopentane-1,2-diamine is sourced from PubChem (CID 159909589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).