C14H22N2 — CID 63994524
N-(2,4-dimethylcyclohexyl)-5-methylpyridin-2-amine (PubChem CID 63994524) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-(2,4-dimethylcyclohexyl)-5-methylpyridin-2-amine.
| Compound Name | N-(2,4-dimethylcyclohexyl)-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 63994524 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-(2,4-dimethylcyclohexyl)-5-methylpyridin-2-amine |
| SMILES | Cc1ccc(NC2CCC(C)CC2C)nc1 |
| InChI | InChI=1S/C14H22N2/c1-10-4-6-13(12(3)8-10)16-14-7-5-11(2)9-15-14/h5,7,9-10,12-13H,4,6,8H2,1-3H3,(H,15,16) |
| InChIKey | LUYJINXBWACYJH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |