C11H16IN3 — CID 58464157
2-N-(5-iodo-2-pyridinyl)cyclohexane-1,2-diamine (PubChem CID 58464157) has the molecular formula C11H16IN3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 2-N-(5-iodo-2-pyridinyl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(5-iodo-2-pyridinyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 58464157 |
| Molecular Formula | C11H16IN3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-N-(5-iodo-2-pyridinyl)cyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1Nc1ccc(I)cn1 |
| InChI | InChI=1S/C11H16IN3/c12-8-5-6-11(14-7-8)15-10-4-2-1-3-9(10)13/h5-7,9-10H,1-4,13H2,(H,14,15) |
| InChIKey | HACXCYBXLNFOQQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|