C10H14IN3 — CID 171746116
3-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine (PubChem CID 171746116) has the molecular formula C10H14IN3 and a molecular weight of 303.15 g/mol. Its IUPAC name is 3-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 171746116 |
| Molecular Formula | C10H14IN3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 3-N-(5-iodo-2-pyridinyl)cyclopentane-1,3-diamine |
| SMILES | NC1CCC(Nc2ccc(I)cn2)C1 |
| InChI | InChI=1S/C10H14IN3/c11-7-1-4-10(13-6-7)14-9-3-2-8(12)5-9/h1,4,6,8-9H,2-3,5,12H2,(H,13,14) |
| InChIKey | BGRPKNKYGLTADM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|