About N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide
N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide (PubChem CID 125491431) has the molecular formula C17H16BrClN2O
and a molecular weight of 379.69 g/mol. Its IUPAC name is N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide |
| PubChem CID | 125491431 |
| Molecular Formula | C17H16BrClN2O |
| Molecular Weight | 379.69 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCC[C@H]1c1ccccc1Br)c1cccnc1Cl |
| InChI | InChI=1S/C17H16BrClN2O/c18-14-8-2-1-5-11(14)12-6-3-9-15(12)21-17(22)13-7-4-10-20-16(13)19/h1-2,4-5,7-8,10,12,15H,3,6,9H2,(H,21,22)/t12-,15-/m0/s1 |
| InChIKey | ZYAAHFWHMDNTFK-WFASDCNBSA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide?
The IUPAC name of N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide (CID 125491431) is N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide.
What is the SMILES notation for N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide?
The canonical SMILES for N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide is O=C(N[C@H]1CCC[C@H]1c1ccccc1Br)c1cccnc1Cl.
What is the InChIKey of N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide?
The InChIKey is ZYAAHFWHMDNTFK-WFASDCNBSA-N. The full InChI is InChI=1S/C17H16BrClN2O/c18-14-8-2-1-5-11(14)12-6-3-9-15(12)21-17(22)13-7-4-10-20-16(13)19/h1-2,4-5,7-8,10,12,15H,3,6,9H2,(H,21,22)/t12-,15-/m0/s1.
What are the key properties of N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide?
N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide has a molecular weight of 379.69 g/mol, XLogP of 4.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-2-(2-bromophenyl)cyclopentyl]-2-chloropyridine-3-carboxamide is sourced from PubChem (CID 125491431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).