C10H11ClN2O3S — CID 6595863
2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]pyridine-3-carboxamide (PubChem CID 6595863) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6595863 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1cccnc1Cl |
| InChI | InChI=1S/C10H11ClN2O3S/c11-9-8(2-1-4-12-9)10(14)13-7-3-5-17(15,16)6-7/h1-2,4,7H,3,5-6H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | RRFUWQKAODQINI-ZETCQYMHSA-N |
| XLogP | 0.65 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|